C20H29NO6S — CID 90139073
tert-butyl 4-(4-methoxyphenyl)sulfonyl-1-oxa-4-azaspiro[4.5]decane-8-carboxylate (PubChem CID 90139073) has the molecular formula C20H29NO6S and a molecular weight of 411.52 g/mol. Its IUPAC name is tert-butyl 4-(4-methoxyphenyl)sulfonyl-1-oxa-4-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 4-(4-methoxyphenyl)sulfonyl-1-oxa-4-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 90139073 |
| Molecular Formula | C20H29NO6S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | tert-butyl 4-(4-methoxyphenyl)sulfonyl-1-oxa-4-azaspiro[4.5]decane-8-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)N2CCOC23CCC(C(=O)OC(C)(C)C)CC3)cc1 |
| InChI | InChI=1S/C20H29NO6S/c1-19(2,3)27-18(22)15-9-11-20(12-10-15)21(13-14-26-20)28(23,24)17-7-5-16(25-4)6-8-17/h5-8,15H,9-14H2,1-4H3 |
| InChIKey | VSJFCZASZMBXNE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |