C15H21N2O4S+ — CID 91177963
4-(4-methoxyphenyl)sulfonyl-8-methylidene-1-oxa-4-aza-8-azoniaspiro[4.5]decane (PubChem CID 91177963) has the molecular formula C15H21N2O4S+ and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-8-methylidene-1-oxa-4-aza-8-azoniaspiro[4.5]decane.
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-8-methylidene-1-oxa-4-aza-8-azoniaspiro[4.5]decane |
|---|---|
| PubChem CID | 91177963 |
| Molecular Formula | C15H21N2O4S+ |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-8-methylidene-1-oxa-4-aza-8-azoniaspiro[4.5]decane |
| SMILES | C=[N+]1CCC2(CC1)OCCN2S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H21N2O4S/c1-16-9-7-15(8-10-16)17(11-12-21-15)22(18,19)14-5-3-13(20-2)4-6-14/h3-6H,1,7-12H2,2H3/q+1 |
| InChIKey | TZVHBAPIAZCLBO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|