C19H27N3S — CID 122607327
N,N-dimethyl-4-[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)ethyl]cyclohexan-1-amine (PubChem CID 122607327) has the molecular formula C19H27N3S and a molecular weight of 329.51 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)ethyl]cyclohexan-1-amine.
| Compound Name | N,N-dimethyl-4-[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 122607327 |
| Molecular Formula | C19H27N3S |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | N,N-dimethyl-4-[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)ethyl]cyclohexan-1-amine |
| SMILES | CN(C)C1CCC(CCc2ncnc3sc4c(c23)CCC4)CC1 |
| InChI | InChI=1S/C19H27N3S/c1-22(2)14-9-6-13(7-10-14)8-11-16-18-15-4-3-5-17(15)23-19(18)21-12-20-16/h12-14H,3-11H2,1-2H3 |
| InChIKey | QJEOOBHKVAJJLM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |