C18H26N4OS — CID 70957684
[(1S,5R)-5-(dimethylamino)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)cyclohexyl]methanol (PubChem CID 70957684) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is [(1S,5R)-5-(dimethylamino)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)cyclohexyl]methanol.
| Compound Name | [(1S,5R)-5-(dimethylamino)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)cyclohexyl]methanol |
|---|---|
| PubChem CID | 70957684 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(1S,5R)-5-(dimethylamino)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)cyclohexyl]methanol |
| SMILES | CN(C)[C@@H]1CCC(Nc2ncnc3sc4c(c23)CCC4)[C@@H](CO)C1 |
| InChI | InChI=1S/C18H26N4OS/c1-22(2)12-6-7-14(11(8-12)9-23)21-17-16-13-4-3-5-15(13)24-18(16)20-10-19-17/h10-12,14,23H,3-9H2,1-2H3,(H,19,20,21)/t11-,12-,14?/m1/s1 |
| InChIKey | QHDPCGOHTQTNIE-QAYQGLBKSA-N |
| XLogP | 2.68 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |