C26H32N4OS — CID 123962061
[3-[[cyclopropyl-[4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)cyclohexyl]amino]methyl]phenyl]methanol (PubChem CID 123962061) has the molecular formula C26H32N4OS and a molecular weight of 448.64 g/mol. Its IUPAC name is [3-[[cyclopropyl-[4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)cyclohexyl]amino]methyl]phenyl]methanol.
| Compound Name | [3-[[cyclopropyl-[4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)cyclohexyl]amino]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 123962061 |
| Molecular Formula | C26H32N4OS |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | [3-[[cyclopropyl-[4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)cyclohexyl]amino]methyl]phenyl]methanol |
| SMILES | OCc1cccc(CN(C2CCC(Nc3ncnc4sc5c(c34)CCC5)CC2)C2CC2)c1 |
| InChI | InChI=1S/C26H32N4OS/c31-15-18-4-1-3-17(13-18)14-30(21-11-12-21)20-9-7-19(8-10-20)29-25-24-22-5-2-6-23(22)32-26(24)28-16-27-25/h1,3-4,13,16,19-21,31H,2,5-12,14-15H2,(H,27,28,29) |
| InChIKey | ISIKIQASQFENSL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |