C17H25N4OS+ — CID 123609082
hydroxy-dimethyl-[4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)cyclohexyl]azanium (PubChem CID 123609082) has the molecular formula C17H25N4OS+ and a molecular weight of 333.48 g/mol. Its IUPAC name is hydroxy-dimethyl-[4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)cyclohexyl]azanium.
| Compound Name | hydroxy-dimethyl-[4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)cyclohexyl]azanium |
|---|---|
| PubChem CID | 123609082 |
| Molecular Formula | C17H25N4OS+ |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | hydroxy-dimethyl-[4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)cyclohexyl]azanium |
| SMILES | C[N+](C)(O)C1CCC(Nc2ncnc3sc4c(c23)CCC4)CC1 |
| InChI | InChI=1S/C17H25N4OS/c1-21(2,22)12-8-6-11(7-9-12)20-16-15-13-4-3-5-14(13)23-17(15)19-10-18-16/h10-12,22H,3-9H2,1-2H3,(H,18,19,20)/q+1 |
| InChIKey | XJWAIEWNNNNNSH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|