C18H22N4S — CID 158844915
12-[4-(3,5-dimethylpyrazol-1-yl)butyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene (PubChem CID 158844915) has the molecular formula C18H22N4S and a molecular weight of 326.47 g/mol. Its IUPAC name is 12-[4-(3,5-dimethylpyrazol-1-yl)butyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene.
| Compound Name | 12-[4-(3,5-dimethylpyrazol-1-yl)butyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
|---|---|
| PubChem CID | 158844915 |
| Molecular Formula | C18H22N4S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 12-[4-(3,5-dimethylpyrazol-1-yl)butyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
| SMILES | Cc1cc(C)n(CCCCc2ncnc3sc4c(c23)CCC4)n1 |
| InChI | InChI=1S/C18H22N4S/c1-12-10-13(2)22(21-12)9-4-3-7-15-17-14-6-5-8-16(14)23-18(17)20-11-19-15/h10-11H,3-9H2,1-2H3 |
| InChIKey | IYRXGZCYMOALTO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|