About (2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone
(2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone (PubChem CID 122608659) has the molecular formula C10H10ClN3O
and a molecular weight of 223.66 g/mol. Its IUPAC name is (2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone.
Molecular Properties
| Compound Name | (2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone |
| PubChem CID | 122608659 |
| Molecular Formula | C10H10ClN3O |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | (2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone |
| SMILES | NC1=NCCN1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C10H10ClN3O/c11-8-4-2-1-3-7(8)9(15)14-6-5-13-10(14)12/h1-4H,5-6H2,(H2,12,13) |
| InChIKey | IXAHFBUPEKAARF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone?
The IUPAC name of (2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone (CID 122608659) is (2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone.
What is the SMILES notation for (2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone?
The canonical SMILES for (2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone is NC1=NCCN1C(=O)c1ccccc1Cl.
What is the InChIKey of (2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone?
The InChIKey is IXAHFBUPEKAARF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN3O/c11-8-4-2-1-3-7(8)9(15)14-6-5-13-10(14)12/h1-4H,5-6H2,(H2,12,13).
What are the key properties of (2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone?
(2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone has a molecular weight of 223.66 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4,5-dihydroimidazol-1-yl)-(2-chlorophenyl)methanone is sourced from PubChem (CID 122608659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).