C17H17Cl2N5O4 — CID 89030737
[2-(4-amino-2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]-[2-[(dihydroxyamino)oxymethyl]phenyl]methanone (PubChem CID 89030737) has the molecular formula C17H17Cl2N5O4 and a molecular weight of 426.26 g/mol. Its IUPAC name is [2-(4-amino-2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]-[2-[(dihydroxyamino)oxymethyl]phenyl]methanone.
| Compound Name | [2-(4-amino-2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]-[2-[(dihydroxyamino)oxymethyl]phenyl]methanone |
|---|---|
| PubChem CID | 89030737 |
| Molecular Formula | C17H17Cl2N5O4 |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | [2-(4-amino-2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]-[2-[(dihydroxyamino)oxymethyl]phenyl]methanone |
| SMILES | Nc1cc(Cl)c(NC2=NCCN2C(=O)c2ccccc2CON(O)O)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N5O4/c18-13-7-11(20)8-14(19)15(13)22-17-21-5-6-23(17)16(25)12-4-2-1-3-10(12)9-28-24(26)27/h1-4,7-8,26-27H,5-6,9,20H2,(H,21,22) |
| InChIKey | BECRBNHHQCEHCP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 123.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|