C12H13Cl2N5O5 — CID 23653467
2-nitrooxyethyl 2-(4-amino-2,6-dichloroanilino)-4,5-dihydroimidazole-1-carboxylate (PubChem CID 23653467) has the molecular formula C12H13Cl2N5O5 and a molecular weight of 378.17 g/mol. Its IUPAC name is 2-nitrooxyethyl 2-(4-amino-2,6-dichloroanilino)-4,5-dihydroimidazole-1-carboxylate.
| Compound Name | 2-nitrooxyethyl 2-(4-amino-2,6-dichloroanilino)-4,5-dihydroimidazole-1-carboxylate |
|---|---|
| PubChem CID | 23653467 |
| Molecular Formula | C12H13Cl2N5O5 |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 2-nitrooxyethyl 2-(4-amino-2,6-dichloroanilino)-4,5-dihydroimidazole-1-carboxylate |
| SMILES | Nc1cc(Cl)c(NC2=NCCN2C(=O)OCCO[N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2N5O5/c13-8-5-7(15)6-9(14)10(8)17-11-16-1-2-18(11)12(20)23-3-4-24-19(21)22/h5-6H,1-4,15H2,(H,16,17) |
| InChIKey | VLAGNKARLSMKHP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|