C13H25KO8S — CID 122610897
potassium;1-propoxyhexane;2-sulfobutanedioic acid (PubChem CID 122610897) has the molecular formula C13H25KO8S and a molecular weight of 380.50 g/mol. Its IUPAC name is potassium;1-propoxyhexane;2-sulfobutanedioic acid.
| Compound Name | potassium;1-propoxyhexane;2-sulfobutanedioic acid |
|---|---|
| PubChem CID | 122610897 |
| Molecular Formula | C13H25KO8S |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | potassium;1-propoxyhexane;2-sulfobutanedioic acid |
| SMILES | CC[CH-]OCCCCCC.O=C(O)CC(C(=O)O)S(=O)(=O)O.[K+] |
| InChI | InChI=1S/C9H19O.C4H6O7S.K/c1-3-5-6-7-9-10-8-4-2;5-3(6)1-2(4(7)8)12(9,10)11;/h8H,3-7,9H2,1-2H3;2H,1H2,(H,5,6)(H,7,8)(H,9,10,11);/q-1;;+1 |
| InChIKey | SCHKYIAFXIGYCW-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|