C15H29KO8S — CID 122611023
potassium;1-ethoxynonane;2-sulfobutanedioic acid (PubChem CID 122611023) has the molecular formula C15H29KO8S and a molecular weight of 408.55 g/mol. Its IUPAC name is potassium;1-ethoxynonane;2-sulfobutanedioic acid.
| Compound Name | potassium;1-ethoxynonane;2-sulfobutanedioic acid |
|---|---|
| PubChem CID | 122611023 |
| Molecular Formula | C15H29KO8S |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | potassium;1-ethoxynonane;2-sulfobutanedioic acid |
| SMILES | C[CH-]OCCCCCCCCC.O=C(O)CC(C(=O)O)S(=O)(=O)O.[K+] |
| InChI | InChI=1S/C11H23O.C4H6O7S.K/c1-3-5-6-7-8-9-10-11-12-4-2;5-3(6)1-2(4(7)8)12(9,10)11;/h4H,3,5-11H2,1-2H3;2H,1H2,(H,5,6)(H,7,8)(H,9,10,11);/q-1;;+1 |
| InChIKey | FIPJZANPMLYRKF-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|