About prop-2-enyl anthracene-1-sulfonate
prop-2-enyl anthracene-1-sulfonate (PubChem CID 122611313) has the molecular formula C17H14O3S
and a molecular weight of 298.36 g/mol. Its IUPAC name is prop-2-enyl anthracene-1-sulfonate.
Molecular Properties
| Compound Name | prop-2-enyl anthracene-1-sulfonate |
| PubChem CID | 122611313 |
| Molecular Formula | C17H14O3S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | prop-2-enyl anthracene-1-sulfonate |
| SMILES | C=CCOS(=O)(=O)c1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C17H14O3S/c1-2-10-20-21(18,19)17-9-5-8-15-11-13-6-3-4-7-14(13)12-16(15)17/h2-9,11-12H,1,10H2 |
| InChIKey | AUQZDQWJRLJSEW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl anthracene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl anthracene-1-sulfonate?
The IUPAC name of prop-2-enyl anthracene-1-sulfonate (CID 122611313) is prop-2-enyl anthracene-1-sulfonate.
What is the SMILES notation for prop-2-enyl anthracene-1-sulfonate?
The canonical SMILES for prop-2-enyl anthracene-1-sulfonate is C=CCOS(=O)(=O)c1cccc2cc3ccccc3cc12.
What is the InChIKey of prop-2-enyl anthracene-1-sulfonate?
The InChIKey is AUQZDQWJRLJSEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O3S/c1-2-10-20-21(18,19)17-9-5-8-15-11-13-6-3-4-7-14(13)12-16(15)17/h2-9,11-12H,1,10H2.
What are the key properties of prop-2-enyl anthracene-1-sulfonate?
prop-2-enyl anthracene-1-sulfonate has a molecular weight of 298.36 g/mol, XLogP of 3.88, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl anthracene-1-sulfonate is sourced from PubChem (CID 122611313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).