C19H36N2O2 — CID 122611617
3-(2-decyl-4,5-dihydroimidazol-1-yl)hexanoic acid (PubChem CID 122611617) has the molecular formula C19H36N2O2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 3-(2-decyl-4,5-dihydroimidazol-1-yl)hexanoic acid.
| Compound Name | 3-(2-decyl-4,5-dihydroimidazol-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 122611617 |
| Molecular Formula | C19H36N2O2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 3-(2-decyl-4,5-dihydroimidazol-1-yl)hexanoic acid |
| SMILES | CCCCCCCCCCC1=NCCN1C(CCC)CC(=O)O |
| InChI | InChI=1S/C19H36N2O2/c1-3-5-6-7-8-9-10-11-13-18-20-14-15-21(18)17(12-4-2)16-19(22)23/h17H,3-16H2,1-2H3,(H,22,23) |
| InChIKey | RUKIKJKXDRWVBI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|