C10H10F5N7 — CID 122616759
5-(3,3,4,4,4-pentafluorobutyl)-3-(trideuteriomethyl)triazolo[4,5-d]pyrimidine-7-carboximidamide (PubChem CID 122616759) has the molecular formula C10H10F5N7 and a molecular weight of 326.25 g/mol. Its IUPAC name is 5-(3,3,4,4,4-pentafluorobutyl)-3-(trideuteriomethyl)triazolo[4,5-d]pyrimidine-7-carboximidamide.
| Compound Name | 5-(3,3,4,4,4-pentafluorobutyl)-3-(trideuteriomethyl)triazolo[4,5-d]pyrimidine-7-carboximidamide |
|---|---|
| PubChem CID | 122616759 |
| Molecular Formula | C10H10F5N7 |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 5-(3,3,4,4,4-pentafluorobutyl)-3-(trideuteriomethyl)triazolo[4,5-d]pyrimidine-7-carboximidamide |
| SMILES | [H]/N=C(\N)c1nc(CCC(F)(F)C(F)(F)F)nc2c1nnn2C([2H])([2H])[2H] |
| InChI | InChI=1S/C10H10F5N7/c1-22-8-6(20-21-22)5(7(16)17)18-4(19-8)2-3-9(11,12)10(13,14)15/h2-3H2,1H3,(H3,16,17)/i1D3 |
| InChIKey | LNUCJLJBTXCEOY-FIBGUPNXSA-N |
| XLogP | 1.17 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|