C24H17Cl4FN2O2 — CID 122617932
5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-2-fluoro-N-methyl-N-phenylbenzamide (PubChem CID 122617932) has the molecular formula C24H17Cl4FN2O2 and a molecular weight of 526.22 g/mol. Its IUPAC name is 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-2-fluoro-N-methyl-N-phenylbenzamide.
| Compound Name | 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-2-fluoro-N-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 122617932 |
| Molecular Formula | C24H17Cl4FN2O2 |
| Molecular Weight | 526.22 g/mol |
| Exact Mass | 524.00 |
| IUPAC Name | 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-2-fluoro-N-methyl-N-phenylbenzamide |
| SMILES | CN(C(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1F)c1ccccc1 |
| InChI | InChI=1S/C24H17Cl4FN2O2/c1-31(17-5-3-2-4-6-17)23(33)18-12-16(7-8-19(18)29)30-22(32)21-20(24(21,27)28)13-9-14(25)11-15(26)10-13/h2-12,20-21H,1H3,(H,30,32) |
| InChIKey | CFKANHSICBOBGC-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.22 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|