C28H32N2O5S — CID 122619789
1-(4-methylsulfanylphenyl)-1-naphthalen-1-yl-N-(3-piperidin-1-ylpropoxy)methanimine;oxalic acid (PubChem CID 122619789) has the molecular formula C28H32N2O5S and a molecular weight of 508.64 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)-1-naphthalen-1-yl-N-(3-piperidin-1-ylpropoxy)methanimine;oxalic acid.
| Compound Name | 1-(4-methylsulfanylphenyl)-1-naphthalen-1-yl-N-(3-piperidin-1-ylpropoxy)methanimine;oxalic acid |
|---|---|
| PubChem CID | 122619789 |
| Molecular Formula | C28H32N2O5S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)-1-naphthalen-1-yl-N-(3-piperidin-1-ylpropoxy)methanimine;oxalic acid |
| SMILES | CSc1ccc(C(=NOCCCN2CCCCC2)c2cccc3ccccc23)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H30N2OS.C2H2O4/c1-30-23-15-13-22(14-16-23)26(25-12-7-10-21-9-3-4-11-24(21)25)27-29-20-8-19-28-17-5-2-6-18-28;3-1(4)2(5)6/h3-4,7,9-16H,2,5-6,8,17-20H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | LCRGYGAJLSMQLY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|