C72H69N18O4P — CID 122621889
tris[1-[5-(3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl)pyrimidin-2-yl]piperidin-4-yl] phosphate (PubChem CID 122621889) has the molecular formula C72H69N18O4P and a molecular weight of 1281.44 g/mol. Its IUPAC name is tris[1-[5-(3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl)pyrimidin-2-yl]piperidin-4-yl] phosphate.
| Compound Name | tris[1-[5-(3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl)pyrimidin-2-yl]piperidin-4-yl] phosphate |
|---|---|
| PubChem CID | 122621889 |
| Molecular Formula | C72H69N18O4P |
| Molecular Weight | 1281.44 g/mol |
| Exact Mass | 1280.55 |
| IUPAC Name | tris[1-[5-(3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl)pyrimidin-2-yl]piperidin-4-yl] phosphate |
| SMILES | O=P(OC1CCN(c2ncc(-c3ccc4nc5n(c4n3)C(c3ccccc3)CC5)cn2)CC1)(OC1CCN(c2ncc(-c3ccc4nc5n(c4n3)C(c3ccccc3)CC5)cn2)CC1)OC1CCN(c2ncc(-c3ccc4nc5n(c4n3)C(c3ccccc3)CC5)cn2)CC1 |
| InChI | InChI=1S/C72H69N18O4P/c91-95(92-52-28-34-85(35-29-52)70-73-40-49(41-74-70)55-16-19-58-67(82-55)88-61(22-25-64(88)79-58)46-10-4-1-5-11-46,93-53-30-36-86(37-31-53)71-75-42-50(43-76-71)56-17-20-59-68(83-56)89-62(23-26-65(89)80-59)47-12-6-2-7-13-47)94-54-32-38-87(39-33-54)72-77-44-51(45-78-72)57-18-21-60-69(84-57)90-63(24-27-66(90)81-60)48-14-8-3-9-15-48/h1-21,40-45,52-54,61-63H,22-39H2 |
| InChIKey | YQGOEFKAMDVXDM-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 223.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 95 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1281.44 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|