C23H17Cl2N9O2 — CID 122623985
7-[5-(6-amino-2-chloro-3-pyridinyl)-1H-imidazol-2-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol (PubChem CID 122623985) has the molecular formula C23H17Cl2N9O2 and a molecular weight of 522.36 g/mol. Its IUPAC name is 7-[5-(6-amino-2-chloro-3-pyridinyl)-1H-imidazol-2-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol.
| Compound Name | 7-[5-(6-amino-2-chloro-3-pyridinyl)-1H-imidazol-2-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol |
|---|---|
| PubChem CID | 122623985 |
| Molecular Formula | C23H17Cl2N9O2 |
| Molecular Weight | 522.36 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 7-[5-(6-amino-2-chloro-3-pyridinyl)-1H-imidazol-2-yl]-3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxido-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ol |
| SMILES | Nc1ccc(-c2cnc(C3(O)CCc4cc(-c5cc(Cl)ccc5-n5cnnn5)c[n+]([O-])c43)[nH]2)c(Cl)n1 |
| InChI | InChI=1S/C23H17Cl2N9O2/c24-14-1-3-18(33-11-28-31-32-33)16(8-14)13-7-12-5-6-23(35,20(12)34(36)10-13)22-27-9-17(29-22)15-2-4-19(26)30-21(15)25/h1-4,7-11,35H,5-6H2,(H2,26,30)(H,27,29) |
| InChIKey | WRUAIWQCTWSNKN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 158.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|