C64H39N3 — CID 122629712
2-(3-cyclohexa-1,2,3,5-tetraen-1-yl-5-phenylphenyl)-4-(3,5-diphenylphenyl)-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine (PubChem CID 122629712) has the molecular formula C64H39N3 and a molecular weight of 850.04 g/mol. Its IUPAC name is 2-(3-cyclohexa-1,2,3,5-tetraen-1-yl-5-phenylphenyl)-4-(3,5-diphenylphenyl)-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine.
| Compound Name | 2-(3-cyclohexa-1,2,3,5-tetraen-1-yl-5-phenylphenyl)-4-(3,5-diphenylphenyl)-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 122629712 |
| Molecular Formula | C64H39N3 |
| Molecular Weight | 850.04 g/mol |
| Exact Mass | 849.31 |
| IUPAC Name | 2-(3-cyclohexa-1,2,3,5-tetraen-1-yl-5-phenylphenyl)-4-(3,5-diphenylphenyl)-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine |
| SMILES | C1=C=C(c2cc(-c3ccccc3)cc(-c3nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)nc(-c4ccc5c(c4)C4(c6ccccc6-c6ccccc64)c4ccccc4-5)n3)c2)C=CC=1 |
| InChI | InChI=1S/C64H39N3/c1-5-19-42(20-6-1)47-35-48(43-21-7-2-8-22-43)38-51(37-47)62-65-61(66-63(67-62)52-39-49(44-23-9-3-10-24-44)36-50(40-52)45-25-11-4-12-26-45)46-33-34-56-55-29-15-18-32-59(55)64(60(56)41-46)57-30-16-13-27-53(57)54-28-14-17-31-58(54)64/h1-11,13-25,27-41H |
| InChIKey | UHYWGRJPYOIHLP-UHFFFAOYSA-N |
| XLogP | 15.48 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.04 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |