C17H9ClFN3OS — CID 122631144
5-[2-(2-chloro-1,3-thiazol-4-yl)ethynyl]-2-fluoro-N-pyridin-3-ylbenzamide (PubChem CID 122631144) has the molecular formula C17H9ClFN3OS and a molecular weight of 357.80 g/mol. Its IUPAC name is 5-[2-(2-chloro-1,3-thiazol-4-yl)ethynyl]-2-fluoro-N-pyridin-3-ylbenzamide.
| Compound Name | 5-[2-(2-chloro-1,3-thiazol-4-yl)ethynyl]-2-fluoro-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 122631144 |
| Molecular Formula | C17H9ClFN3OS |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 5-[2-(2-chloro-1,3-thiazol-4-yl)ethynyl]-2-fluoro-N-pyridin-3-ylbenzamide |
| SMILES | O=C(Nc1cccnc1)c1cc(C#Cc2csc(Cl)n2)ccc1F |
| InChI | InChI=1S/C17H9ClFN3OS/c18-17-22-13(10-24-17)5-3-11-4-6-15(19)14(8-11)16(23)21-12-2-1-7-20-9-12/h1-2,4,6-10H,(H,21,23) |
| InChIKey | AWGQKHCMDYSSRN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|