C18H12FN3OS — CID 122631598
2-fluoro-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-N-pyridin-3-ylbenzamide (PubChem CID 122631598) has the molecular formula C18H12FN3OS and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-fluoro-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-N-pyridin-3-ylbenzamide.
| Compound Name | 2-fluoro-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 122631598 |
| Molecular Formula | C18H12FN3OS |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-fluoro-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-N-pyridin-3-ylbenzamide |
| SMILES | Cc1nc(C#Cc2ccc(F)c(C(=O)Nc3cccnc3)c2)cs1 |
| InChI | InChI=1S/C18H12FN3OS/c1-12-21-15(11-24-12)6-4-13-5-7-17(19)16(9-13)18(23)22-14-3-2-8-20-10-14/h2-3,5,7-11H,1H3,(H,22,23) |
| InChIKey | PHRKBBLWXYVGDL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|