C9H6BrN3OS — CID 141426406
2-bromo-N-pyridin-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 141426406) has the molecular formula C9H6BrN3OS and a molecular weight of 284.14 g/mol. Its IUPAC name is 2-bromo-N-pyridin-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-bromo-N-pyridin-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 141426406 |
| Molecular Formula | C9H6BrN3OS |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 282.94 |
| IUPAC Name | 2-bromo-N-pyridin-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1csc(Br)n1 |
| InChI | InChI=1S/C9H6BrN3OS/c10-9-13-7(5-15-9)8(14)12-6-2-1-3-11-4-6/h1-5H,(H,12,14) |
| InChIKey | MGYHJUSXZSMKRN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |