C24H16N6O2 — CID 155927483
2-N,9-N-dipyridin-3-yl-1,10-phenanthroline-2,9-dicarboxamide (PubChem CID 155927483) has the molecular formula C24H16N6O2 and a molecular weight of 420.43 g/mol. Its IUPAC name is 2-N,9-N-dipyridin-3-yl-1,10-phenanthroline-2,9-dicarboxamide.
| Compound Name | 2-N,9-N-dipyridin-3-yl-1,10-phenanthroline-2,9-dicarboxamide |
|---|---|
| PubChem CID | 155927483 |
| Molecular Formula | C24H16N6O2 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-N,9-N-dipyridin-3-yl-1,10-phenanthroline-2,9-dicarboxamide |
| SMILES | O=C(Nc1cccnc1)c1ccc2ccc3ccc(C(=O)Nc4cccnc4)nc3c2n1 |
| InChI | InChI=1S/C24H16N6O2/c31-23(27-17-3-1-11-25-13-17)19-9-7-15-5-6-16-8-10-20(30-22(16)21(15)29-19)24(32)28-18-4-2-12-26-14-18/h1-14H,(H,27,31)(H,28,32) |
| InChIKey | XILRLNBNGWXVJF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|