C18H20N4O2 — CID 122634957
(9aS)-4-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]-6,7,8,9a-tetrahydro-1H-pyrido[1,2-d][1,2,4]oxadiazin-9-one (PubChem CID 122634957) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is (9aS)-4-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]-6,7,8,9a-tetrahydro-1H-pyrido[1,2-d][1,2,4]oxadiazin-9-one.
| Compound Name | (9aS)-4-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]-6,7,8,9a-tetrahydro-1H-pyrido[1,2-d][1,2,4]oxadiazin-9-one |
|---|---|
| PubChem CID | 122634957 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (9aS)-4-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]-6,7,8,9a-tetrahydro-1H-pyrido[1,2-d][1,2,4]oxadiazin-9-one |
| SMILES | Cc1cn(-c2ccc(C3=NOC[C@H]4C(=O)CCCN34)cc2C)cn1 |
| InChI | InChI=1S/C18H20N4O2/c1-12-8-14(5-6-15(12)21-9-13(2)19-11-21)18-20-24-10-16-17(23)4-3-7-22(16)18/h5-6,8-9,11,16H,3-4,7,10H2,1-2H3/t16-/m0/s1 |
| InChIKey | HLIJILPQCNBOQO-INIZCTEOSA-N |
| XLogP | 2.21 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |