C26H30F2N4O2S — CID 144857634
9-(3,5-difluorophenyl)sulfanyl-4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-1,6,7,8,9,9a-hexahydropyrido[1,2-d][1,2,4]oxadiazine;ethane (PubChem CID 144857634) has the molecular formula C26H30F2N4O2S and a molecular weight of 500.62 g/mol. Its IUPAC name is 9-(3,5-difluorophenyl)sulfanyl-4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-1,6,7,8,9,9a-hexahydropyrido[1,2-d][1,2,4]oxadiazine;ethane.
| Compound Name | 9-(3,5-difluorophenyl)sulfanyl-4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-1,6,7,8,9,9a-hexahydropyrido[1,2-d][1,2,4]oxadiazine;ethane |
|---|---|
| PubChem CID | 144857634 |
| Molecular Formula | C26H30F2N4O2S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 9-(3,5-difluorophenyl)sulfanyl-4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-1,6,7,8,9,9a-hexahydropyrido[1,2-d][1,2,4]oxadiazine;ethane |
| SMILES | CC.COc1cc(C2=NOCC3C(Sc4cc(F)cc(F)c4)CCCN23)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H24F2N4O2S.C2H6/c1-15-12-29(14-27-15)20-6-5-16(8-22(20)31-2)24-28-32-13-21-23(4-3-7-30(21)24)33-19-10-17(25)9-18(26)11-19;1-2/h5-6,8-12,14,21,23H,3-4,7,13H2,1-2H3;1-2H3 |
| InChIKey | GXEFHZJHWLCZHE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |