C24H24F2N4O — CID 122634959
(9aR)-9-(3,5-difluorophenyl)-4-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]-1,6,7,8,9,9a-hexahydropyrido[1,2-d][1,2,4]oxadiazine (PubChem CID 122634959) has the molecular formula C24H24F2N4O and a molecular weight of 422.48 g/mol. Its IUPAC name is (9aR)-9-(3,5-difluorophenyl)-4-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]-1,6,7,8,9,9a-hexahydropyrido[1,2-d][1,2,4]oxadiazine.
| Compound Name | (9aR)-9-(3,5-difluorophenyl)-4-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]-1,6,7,8,9,9a-hexahydropyrido[1,2-d][1,2,4]oxadiazine |
|---|---|
| PubChem CID | 122634959 |
| Molecular Formula | C24H24F2N4O |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (9aR)-9-(3,5-difluorophenyl)-4-[3-methyl-4-(4-methylimidazol-1-yl)phenyl]-1,6,7,8,9,9a-hexahydropyrido[1,2-d][1,2,4]oxadiazine |
| SMILES | Cc1cn(-c2ccc(C3=NOC[C@H]4C(c5cc(F)cc(F)c5)CCCN34)cc2C)cn1 |
| InChI | InChI=1S/C24H24F2N4O/c1-15-8-17(5-6-22(15)29-12-16(2)27-14-29)24-28-31-13-23-21(4-3-7-30(23)24)18-9-19(25)11-20(26)10-18/h5-6,8-12,14,21,23H,3-4,7,13H2,1-2H3/t21?,23-/m0/s1 |
| InChIKey | HOTNCWIADNCMHF-YANBTOMASA-N |
| XLogP | 4.71 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |