C23H33BrFNO6 — CID 122635994
tert-butyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-bromo-2-fluorophenyl)propanoate (PubChem CID 122635994) has the molecular formula C23H33BrFNO6 and a molecular weight of 518.42 g/mol. Its IUPAC name is tert-butyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-bromo-2-fluorophenyl)propanoate.
| Compound Name | tert-butyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-bromo-2-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 122635994 |
| Molecular Formula | C23H33BrFNO6 |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | tert-butyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-bromo-2-fluorophenyl)propanoate |
| SMILES | CC(C)(C)OC(=O)C(Cc1ccc(Br)cc1F)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33BrFNO6/c1-21(2,3)30-18(27)17(12-14-10-11-15(24)13-16(14)25)26(19(28)31-22(4,5)6)20(29)32-23(7,8)9/h10-11,13,17H,12H2,1-9H3 |
| InChIKey | VROOXSOJOPQISV-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|