C23H31BrFNO7 — CID 146165390
methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2-bromo-5-fluorophenyl)-6-oxohexanoate (PubChem CID 146165390) has the molecular formula C23H31BrFNO7 and a molecular weight of 532.40 g/mol. Its IUPAC name is methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2-bromo-5-fluorophenyl)-6-oxohexanoate.
| Compound Name | methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2-bromo-5-fluorophenyl)-6-oxohexanoate |
|---|---|
| PubChem CID | 146165390 |
| Molecular Formula | C23H31BrFNO7 |
| Molecular Weight | 532.40 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2-bromo-5-fluorophenyl)-6-oxohexanoate |
| SMILES | COC(=O)[C@H](CCCC(=O)c1cc(F)ccc1Br)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H31BrFNO7/c1-22(2,3)32-20(29)26(21(30)33-23(4,5)6)17(19(28)31-7)9-8-10-18(27)15-13-14(25)11-12-16(15)24/h11-13,17H,8-10H2,1-7H3/t17-/m0/s1 |
| InChIKey | VSYBIKSMASWNPM-KRWDZBQOSA-N |
| XLogP | 5.66 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.40 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|