C16H16ClN5O2 — CID 122637676
3-[[(1R)-1-(6-chloro-2-oxo-1H-quinolin-3-yl)ethyl]amino]-1-methylpyrazole-5-carboxamide (PubChem CID 122637676) has the molecular formula C16H16ClN5O2 and a molecular weight of 345.79 g/mol. Its IUPAC name is 3-[[(1R)-1-(6-chloro-2-oxo-1H-quinolin-3-yl)ethyl]amino]-1-methylpyrazole-5-carboxamide.
| Compound Name | 3-[[(1R)-1-(6-chloro-2-oxo-1H-quinolin-3-yl)ethyl]amino]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122637676 |
| Molecular Formula | C16H16ClN5O2 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3-[[(1R)-1-(6-chloro-2-oxo-1H-quinolin-3-yl)ethyl]amino]-1-methylpyrazole-5-carboxamide |
| SMILES | C[C@@H](Nc1cc(C(N)=O)n(C)n1)c1cc2cc(Cl)ccc2[nH]c1=O |
| InChI | InChI=1S/C16H16ClN5O2/c1-8(19-14-7-13(15(18)23)22(2)21-14)11-6-9-5-10(17)3-4-12(9)20-16(11)24/h3-8H,1-2H3,(H2,18,23)(H,19,21)(H,20,24)/t8-/m1/s1 |
| InChIKey | NDIULLCKSJTLDM-MRVPVSSYSA-N |
| XLogP | 2.19 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |