C31H37N5O4 — CID 122639476
N-[7-(2,3-dimethoxyphenyl)-3-oxo-1,2-dihydroisoindol-4-yl]-4-[3-(4-methylpiperazin-1-yl)propylamino]benzamide (PubChem CID 122639476) has the molecular formula C31H37N5O4 and a molecular weight of 543.67 g/mol. Its IUPAC name is N-[7-(2,3-dimethoxyphenyl)-3-oxo-1,2-dihydroisoindol-4-yl]-4-[3-(4-methylpiperazin-1-yl)propylamino]benzamide.
| Compound Name | N-[7-(2,3-dimethoxyphenyl)-3-oxo-1,2-dihydroisoindol-4-yl]-4-[3-(4-methylpiperazin-1-yl)propylamino]benzamide |
|---|---|
| PubChem CID | 122639476 |
| Molecular Formula | C31H37N5O4 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | N-[7-(2,3-dimethoxyphenyl)-3-oxo-1,2-dihydroisoindol-4-yl]-4-[3-(4-methylpiperazin-1-yl)propylamino]benzamide |
| SMILES | COc1cccc(-c2ccc(NC(=O)c3ccc(NCCCN4CCN(C)CC4)cc3)c3c2CNC3=O)c1OC |
| InChI | InChI=1S/C31H37N5O4/c1-35-16-18-36(19-17-35)15-5-14-32-22-10-8-21(9-11-22)30(37)34-26-13-12-23(25-20-33-31(38)28(25)26)24-6-4-7-27(39-2)29(24)40-3/h4,6-13,32H,5,14-20H2,1-3H3,(H,33,38)(H,34,37) |
| InChIKey | DSOSXOBNXRDSJZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|