C22H21N3O4 — CID 122639060
N-[7-(furan-2-yl)-3-oxo-1,2-dihydroisoindol-4-yl]-4-(2-methoxyethylamino)benzamide (PubChem CID 122639060) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[7-(furan-2-yl)-3-oxo-1,2-dihydroisoindol-4-yl]-4-(2-methoxyethylamino)benzamide.
| Compound Name | N-[7-(furan-2-yl)-3-oxo-1,2-dihydroisoindol-4-yl]-4-(2-methoxyethylamino)benzamide |
|---|---|
| PubChem CID | 122639060 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[7-(furan-2-yl)-3-oxo-1,2-dihydroisoindol-4-yl]-4-(2-methoxyethylamino)benzamide |
| SMILES | COCCNc1ccc(C(=O)Nc2ccc(-c3ccco3)c3c2C(=O)NC3)cc1 |
| InChI | InChI=1S/C22H21N3O4/c1-28-12-10-23-15-6-4-14(5-7-15)21(26)25-18-9-8-16(19-3-2-11-29-19)17-13-24-22(27)20(17)18/h2-9,11,23H,10,12-13H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | ZNTSIQFFKMVJRM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|