C23H19FN2O4 — CID 122639167
N-[7-(2,3-dimethoxyphenyl)-3-oxo-1,2-dihydroisoindol-4-yl]-4-fluorobenzamide (PubChem CID 122639167) has the molecular formula C23H19FN2O4 and a molecular weight of 406.41 g/mol. Its IUPAC name is N-[7-(2,3-dimethoxyphenyl)-3-oxo-1,2-dihydroisoindol-4-yl]-4-fluorobenzamide.
| Compound Name | N-[7-(2,3-dimethoxyphenyl)-3-oxo-1,2-dihydroisoindol-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 122639167 |
| Molecular Formula | C23H19FN2O4 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-[7-(2,3-dimethoxyphenyl)-3-oxo-1,2-dihydroisoindol-4-yl]-4-fluorobenzamide |
| SMILES | COc1cccc(-c2ccc(NC(=O)c3ccc(F)cc3)c3c2CNC3=O)c1OC |
| InChI | InChI=1S/C23H19FN2O4/c1-29-19-5-3-4-16(21(19)30-2)15-10-11-18(20-17(15)12-25-23(20)28)26-22(27)13-6-8-14(24)9-7-13/h3-11H,12H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | JCPUORSBHGZRID-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |