C24H24N2O4 — CID 147020302
N-[7-(furan-2-yl)-3-oxo-1,2-dihydroinden-4-yl]-4-(3-methoxypropylamino)benzamide (PubChem CID 147020302) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[7-(furan-2-yl)-3-oxo-1,2-dihydroinden-4-yl]-4-(3-methoxypropylamino)benzamide.
| Compound Name | N-[7-(furan-2-yl)-3-oxo-1,2-dihydroinden-4-yl]-4-(3-methoxypropylamino)benzamide |
|---|---|
| PubChem CID | 147020302 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[7-(furan-2-yl)-3-oxo-1,2-dihydroinden-4-yl]-4-(3-methoxypropylamino)benzamide |
| SMILES | COCCCNc1ccc(C(=O)Nc2ccc(-c3ccco3)c3c2C(=O)CC3)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-29-14-3-13-25-17-7-5-16(6-8-17)24(28)26-20-11-9-18(22-4-2-15-30-22)19-10-12-21(27)23(19)20/h2,4-9,11,15,25H,3,10,12-14H2,1H3,(H,26,28) |
| InChIKey | AVOLIBWSIWTWLH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|