C32H35F3N4O2 — CID 160939097
N-[7-[3-methyl-5-(trifluoromethyl)anilino]-3-oxo-1,2-dihydroinden-4-yl]-4-(3-piperidin-1-ylpropylamino)benzamide (PubChem CID 160939097) has the molecular formula C32H35F3N4O2 and a molecular weight of 564.65 g/mol. Its IUPAC name is N-[7-[3-methyl-5-(trifluoromethyl)anilino]-3-oxo-1,2-dihydroinden-4-yl]-4-(3-piperidin-1-ylpropylamino)benzamide.
| Compound Name | N-[7-[3-methyl-5-(trifluoromethyl)anilino]-3-oxo-1,2-dihydroinden-4-yl]-4-(3-piperidin-1-ylpropylamino)benzamide |
|---|---|
| PubChem CID | 160939097 |
| Molecular Formula | C32H35F3N4O2 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | N-[7-[3-methyl-5-(trifluoromethyl)anilino]-3-oxo-1,2-dihydroinden-4-yl]-4-(3-piperidin-1-ylpropylamino)benzamide |
| SMILES | Cc1cc(Nc2ccc(NC(=O)c3ccc(NCCCN4CCCCC4)cc3)c3c2CCC3=O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H35F3N4O2/c1-21-18-23(32(33,34)35)20-25(19-21)37-27-11-12-28(30-26(27)10-13-29(30)40)38-31(41)22-6-8-24(9-7-22)36-14-5-17-39-15-3-2-4-16-39/h6-9,11-12,18-20,36-37H,2-5,10,13-17H2,1H3,(H,38,41) |
| InChIKey | SUGNRPTUGODBID-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|