C28H30N4O4 — CID 161482084
N-[7-(3-amino-2-hydroxyphenyl)-3-oxo-1,2-dihydroinden-4-yl]-4-(2-morpholin-4-ylethylamino)benzamide (PubChem CID 161482084) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is N-[7-(3-amino-2-hydroxyphenyl)-3-oxo-1,2-dihydroinden-4-yl]-4-(2-morpholin-4-ylethylamino)benzamide.
| Compound Name | N-[7-(3-amino-2-hydroxyphenyl)-3-oxo-1,2-dihydroinden-4-yl]-4-(2-morpholin-4-ylethylamino)benzamide |
|---|---|
| PubChem CID | 161482084 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N-[7-(3-amino-2-hydroxyphenyl)-3-oxo-1,2-dihydroinden-4-yl]-4-(2-morpholin-4-ylethylamino)benzamide |
| SMILES | Nc1cccc(-c2ccc(NC(=O)c3ccc(NCCN4CCOCC4)cc3)c3c2CCC3=O)c1O |
| InChI | InChI=1S/C28H30N4O4/c29-23-3-1-2-22(27(23)34)20-8-10-24(26-21(20)9-11-25(26)33)31-28(35)18-4-6-19(7-5-18)30-12-13-32-14-16-36-17-15-32/h1-8,10,30,34H,9,11-17,29H2,(H,31,35) |
| InChIKey | WEMNVPOUUUKBJP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|