C27H29N5O2S2 — CID 87194750
N-(2-aminophenyl)-4-[[6-(2-morpholin-4-ylethylamino)-1,3-benzothiazol-2-yl]-sulfanylmethyl]benzamide (PubChem CID 87194750) has the molecular formula C27H29N5O2S2 and a molecular weight of 519.70 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[6-(2-morpholin-4-ylethylamino)-1,3-benzothiazol-2-yl]-sulfanylmethyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[6-(2-morpholin-4-ylethylamino)-1,3-benzothiazol-2-yl]-sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 87194750 |
| Molecular Formula | C27H29N5O2S2 |
| Molecular Weight | 519.70 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | N-(2-aminophenyl)-4-[[6-(2-morpholin-4-ylethylamino)-1,3-benzothiazol-2-yl]-sulfanylmethyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(C(S)c2nc3ccc(NCCN4CCOCC4)cc3s2)cc1 |
| InChI | InChI=1S/C27H29N5O2S2/c28-21-3-1-2-4-22(21)30-26(33)19-7-5-18(6-8-19)25(35)27-31-23-10-9-20(17-24(23)36-27)29-11-12-32-13-15-34-16-14-32/h1-10,17,25,29,35H,11-16,28H2,(H,30,33) |
| InChIKey | XUENKIOQCCYRLV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.70 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|