C27H29N5O2S2 — CID 91081384
N-(2-aminophenyl)-4-[[6-[ethyl(morpholin-4-yl)amino]-1,3-benzothiazol-2-yl]sulfanylmethyl]benzamide (PubChem CID 91081384) has the molecular formula C27H29N5O2S2 and a molecular weight of 519.70 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[6-[ethyl(morpholin-4-yl)amino]-1,3-benzothiazol-2-yl]sulfanylmethyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[6-[ethyl(morpholin-4-yl)amino]-1,3-benzothiazol-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 91081384 |
| Molecular Formula | C27H29N5O2S2 |
| Molecular Weight | 519.70 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | N-(2-aminophenyl)-4-[[6-[ethyl(morpholin-4-yl)amino]-1,3-benzothiazol-2-yl]sulfanylmethyl]benzamide |
| SMILES | CCN(c1ccc2nc(SCc3ccc(C(=O)Nc4ccccc4N)cc3)sc2c1)N1CCOCC1 |
| InChI | InChI=1S/C27H29N5O2S2/c1-2-32(31-13-15-34-16-14-31)21-11-12-24-25(17-21)36-27(30-24)35-18-19-7-9-20(10-8-19)26(33)29-23-6-4-3-5-22(23)28/h3-12,17H,2,13-16,18,28H2,1H3,(H,29,33) |
| InChIKey | SVLGWZXZDHDSJX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.70 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|