C24H23N3O3 — CID 160848649
N-(7-anilino-3-oxo-1,2-dihydroinden-4-yl)-4-(2-hydroxyethylamino)benzamide (PubChem CID 160848649) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-(7-anilino-3-oxo-1,2-dihydroinden-4-yl)-4-(2-hydroxyethylamino)benzamide.
| Compound Name | N-(7-anilino-3-oxo-1,2-dihydroinden-4-yl)-4-(2-hydroxyethylamino)benzamide |
|---|---|
| PubChem CID | 160848649 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-(7-anilino-3-oxo-1,2-dihydroinden-4-yl)-4-(2-hydroxyethylamino)benzamide |
| SMILES | O=C(Nc1ccc(Nc2ccccc2)c2c1C(=O)CC2)c1ccc(NCCO)cc1 |
| InChI | InChI=1S/C24H23N3O3/c28-15-14-25-17-8-6-16(7-9-17)24(30)27-21-12-11-20(19-10-13-22(29)23(19)21)26-18-4-2-1-3-5-18/h1-9,11-12,25-26,28H,10,13-15H2,(H,27,30) |
| InChIKey | SIYXTAFXHWMOKM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |