C17H13F3IN5O — CID 122640634
5-amino-1-(2-iodophenyl)-3-[[5-(trifluoromethyl)-2-pyridinyl]methyl]pyrazole-4-carboxamide (PubChem CID 122640634) has the molecular formula C17H13F3IN5O and a molecular weight of 487.22 g/mol. Its IUPAC name is 5-amino-1-(2-iodophenyl)-3-[[5-(trifluoromethyl)-2-pyridinyl]methyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-(2-iodophenyl)-3-[[5-(trifluoromethyl)-2-pyridinyl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 122640634 |
| Molecular Formula | C17H13F3IN5O |
| Molecular Weight | 487.22 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | 5-amino-1-(2-iodophenyl)-3-[[5-(trifluoromethyl)-2-pyridinyl]methyl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(Cc2ccc(C(F)(F)F)cn2)nn(-c2ccccc2I)c1N |
| InChI | InChI=1S/C17H13F3IN5O/c18-17(19,20)9-5-6-10(24-8-9)7-12-14(16(23)27)15(22)26(25-12)13-4-2-1-3-11(13)21/h1-6,8H,7,22H2,(H2,23,27) |
| InChIKey | FQGDLBNDRFLEGX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|