C19H23N5O — CID 122641617
(6R)-2-amino-3,6-dimethyl-6-[2-(2-methylpent-3-yn-2-yl)-3H-benzimidazol-5-yl]-5H-pyrimidin-4-one (PubChem CID 122641617) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is (6R)-2-amino-3,6-dimethyl-6-[2-(2-methylpent-3-yn-2-yl)-3H-benzimidazol-5-yl]-5H-pyrimidin-4-one.
| Compound Name | (6R)-2-amino-3,6-dimethyl-6-[2-(2-methylpent-3-yn-2-yl)-3H-benzimidazol-5-yl]-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 122641617 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (6R)-2-amino-3,6-dimethyl-6-[2-(2-methylpent-3-yn-2-yl)-3H-benzimidazol-5-yl]-5H-pyrimidin-4-one |
| SMILES | CC#CC(C)(C)c1nc2ccc([C@@]3(C)CC(=O)N(C)C(N)=N3)cc2[nH]1 |
| InChI | InChI=1S/C19H23N5O/c1-6-9-18(2,3)16-21-13-8-7-12(10-14(13)22-16)19(4)11-15(25)24(5)17(20)23-19/h7-8,10H,11H2,1-5H3,(H2,20,23)(H,21,22)/t19-/m1/s1 |
| InChIKey | VNRBXKBYCREMEQ-LJQANCHMSA-N |
| XLogP | 2.26 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|