C22H19N3O2 — CID 135222007
2-amino-3,6-dimethyl-6-(9-oxo-6-prop-1-ynylfluoren-3-yl)-5H-pyrimidin-4-one (PubChem CID 135222007) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-amino-3,6-dimethyl-6-(9-oxo-6-prop-1-ynylfluoren-3-yl)-5H-pyrimidin-4-one.
| Compound Name | 2-amino-3,6-dimethyl-6-(9-oxo-6-prop-1-ynylfluoren-3-yl)-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 135222007 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-amino-3,6-dimethyl-6-(9-oxo-6-prop-1-ynylfluoren-3-yl)-5H-pyrimidin-4-one |
| SMILES | CC#Cc1ccc2c(c1)-c1cc(C3(C)CC(=O)N(C)C(N)=N3)ccc1C2=O |
| InChI | InChI=1S/C22H19N3O2/c1-4-5-13-6-8-15-17(10-13)18-11-14(7-9-16(18)20(15)27)22(2)12-19(26)25(3)21(23)24-22/h6-11H,12H2,1-3H3,(H2,23,24) |
| InChIKey | DEZHBAURNXRMAG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|