C21H19N3O2 — CID 135222105
2-amino-3,6-dimethyl-6-(3-prop-1-ynylbenzo[f][1]benzofuran-6-yl)-5H-pyrimidin-4-one (PubChem CID 135222105) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-amino-3,6-dimethyl-6-(3-prop-1-ynylbenzo[f][1]benzofuran-6-yl)-5H-pyrimidin-4-one.
| Compound Name | 2-amino-3,6-dimethyl-6-(3-prop-1-ynylbenzo[f][1]benzofuran-6-yl)-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 135222105 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2-amino-3,6-dimethyl-6-(3-prop-1-ynylbenzo[f][1]benzofuran-6-yl)-5H-pyrimidin-4-one |
| SMILES | CC#Cc1coc2cc3ccc(C4(C)CC(=O)N(C)C(N)=N4)cc3cc12 |
| InChI | InChI=1S/C21H19N3O2/c1-4-5-14-12-26-18-10-13-6-7-16(8-15(13)9-17(14)18)21(2)11-19(25)24(3)20(22)23-21/h6-10,12H,11H2,1-3H3,(H2,22,23) |
| InChIKey | VWVHJYTVFOEVAT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 71.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|