C22H22N2O3S — CID 135222075
3,6,6-trimethyl-1,1-dioxo-3-(3-prop-1-ynylbenzo[f][1]benzofuran-6-yl)-2H-1,4-thiazin-5-amine (PubChem CID 135222075) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 3,6,6-trimethyl-1,1-dioxo-3-(3-prop-1-ynylbenzo[f][1]benzofuran-6-yl)-2H-1,4-thiazin-5-amine.
| Compound Name | 3,6,6-trimethyl-1,1-dioxo-3-(3-prop-1-ynylbenzo[f][1]benzofuran-6-yl)-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 135222075 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 3,6,6-trimethyl-1,1-dioxo-3-(3-prop-1-ynylbenzo[f][1]benzofuran-6-yl)-2H-1,4-thiazin-5-amine |
| SMILES | CC#Cc1coc2cc3ccc(C4(C)CS(=O)(=O)C(C)(C)C(N)=N4)cc3cc12 |
| InChI | InChI=1S/C22H22N2O3S/c1-5-6-15-12-27-19-11-14-7-8-17(9-16(14)10-18(15)19)22(4)13-28(25,26)21(2,3)20(23)24-22/h7-12H,13H2,1-4H3,(H2,23,24) |
| InChIKey | AHWUBJCYCUJWGD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|