C23H24N2O3S2 — CID 122647829
(3R)-3-(7-methoxy-8-prop-1-ynyldibenzothiophen-2-yl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 122647829) has the molecular formula C23H24N2O3S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is (3R)-3-(7-methoxy-8-prop-1-ynyldibenzothiophen-2-yl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R)-3-(7-methoxy-8-prop-1-ynyldibenzothiophen-2-yl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 122647829 |
| Molecular Formula | C23H24N2O3S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | (3R)-3-(7-methoxy-8-prop-1-ynyldibenzothiophen-2-yl)-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | CC#Cc1cc2c(cc1OC)sc1ccc([C@]3(C)CS(=O)(=O)C(C)(C)C(N)=N3)cc12 |
| InChI | InChI=1S/C23H24N2O3S2/c1-6-7-14-10-16-17-11-15(8-9-19(17)29-20(16)12-18(14)28-5)23(4)13-30(26,27)22(2,3)21(24)25-23/h8-12H,13H2,1-5H3,(H2,24,25)/t23-/m0/s1 |
| InChIKey | BFDXYUXFRDFJHX-QHCPKHFHSA-N |
| XLogP | 4.21 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|