C19H23N5O2S2 — CID 122647722
(3R)-3-[2-(2,5-dimethylpyrazol-3-yl)-1,3-benzothiazol-6-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 122647722) has the molecular formula C19H23N5O2S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is (3R)-3-[2-(2,5-dimethylpyrazol-3-yl)-1,3-benzothiazol-6-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R)-3-[2-(2,5-dimethylpyrazol-3-yl)-1,3-benzothiazol-6-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 122647722 |
| Molecular Formula | C19H23N5O2S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (3R)-3-[2-(2,5-dimethylpyrazol-3-yl)-1,3-benzothiazol-6-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | Cc1cc(-c2nc3ccc([C@]4(C)CS(=O)(=O)C(C)(C)C(N)=N4)cc3s2)n(C)n1 |
| InChI | InChI=1S/C19H23N5O2S2/c1-11-8-14(24(5)23-11)16-21-13-7-6-12(9-15(13)27-16)19(4)10-28(25,26)18(2,3)17(20)22-19/h6-9H,10H2,1-5H3,(H2,20,22)/t19-/m0/s1 |
| InChIKey | MQOYPYYHBYQBBO-IBGZPJMESA-N |
| XLogP | 2.78 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |