C18H20O4 — CID 122643932
4-[(E)-4-(4-hydroxy-3-methoxyphenyl)but-2-enyl]-2-(hydroxymethyl)phenol (PubChem CID 122643932) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 4-[(E)-4-(4-hydroxy-3-methoxyphenyl)but-2-enyl]-2-(hydroxymethyl)phenol.
| Compound Name | 4-[(E)-4-(4-hydroxy-3-methoxyphenyl)but-2-enyl]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 122643932 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-[(E)-4-(4-hydroxy-3-methoxyphenyl)but-2-enyl]-2-(hydroxymethyl)phenol |
| SMILES | COc1cc(C/C=C/Cc2ccc(O)c(CO)c2)ccc1O |
| InChI | InChI=1S/C18H20O4/c1-22-18-11-14(7-9-17(18)21)5-3-2-4-13-6-8-16(20)15(10-13)12-19/h2-3,6-11,19-21H,4-5,12H2,1H3/b3-2+ |
| InChIKey | GTCXWULUVPPUID-NSCUHMNNSA-N |
| XLogP | 2.94 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|