C28H31N5O2 — CID 122644959
[(3R)-3-[2-amino-3-(4-phenoxyanilino)pyridine-4-carboximidoyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone (PubChem CID 122644959) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is [(3R)-3-[2-amino-3-(4-phenoxyanilino)pyridine-4-carboximidoyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone.
| Compound Name | [(3R)-3-[2-amino-3-(4-phenoxyanilino)pyridine-4-carboximidoyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone |
|---|---|
| PubChem CID | 122644959 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | [(3R)-3-[2-amino-3-(4-phenoxyanilino)pyridine-4-carboximidoyl]piperidin-1-yl]-(1-methylcyclopropyl)methanone |
| SMILES | [H]/N=C(/c1ccnc(N)c1Nc1ccc(Oc2ccccc2)cc1)[C@@H]1CCCN(C(=O)C2(C)CC2)C1 |
| InChI | InChI=1S/C28H31N5O2/c1-28(14-15-28)27(34)33-17-5-6-19(18-33)24(29)23-13-16-31-26(30)25(23)32-20-9-11-22(12-10-20)35-21-7-3-2-4-8-21/h2-4,7-13,16,19,29,32H,5-6,14-15,17-18H2,1H3,(H2,30,31)/b29-24+/t19-/m1/s1 |
| InChIKey | FQCXWMZBTIMCJW-PCNYTLQMSA-N |
| XLogP | 5.61 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|