C18H29N3O2 — CID 122647066
2,4-diethyl-N,2,4-trimethyl-N'-(6-methyl-3-pyridinyl)pentanediamide (PubChem CID 122647066) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 2,4-diethyl-N,2,4-trimethyl-N'-(6-methyl-3-pyridinyl)pentanediamide.
| Compound Name | 2,4-diethyl-N,2,4-trimethyl-N'-(6-methyl-3-pyridinyl)pentanediamide |
|---|---|
| PubChem CID | 122647066 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 2,4-diethyl-N,2,4-trimethyl-N'-(6-methyl-3-pyridinyl)pentanediamide |
| SMILES | CCC(C)(CC(C)(CC)C(=O)Nc1ccc(C)nc1)C(=O)NC |
| InChI | InChI=1S/C18H29N3O2/c1-7-17(4,15(22)19-6)12-18(5,8-2)16(23)21-14-10-9-13(3)20-11-14/h9-11H,7-8,12H2,1-6H3,(H,19,22)(H,21,23) |
| InChIKey | UAJHBKNDSMKNJE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |