C42H50N4O8 — CID 134463643
1-N,3-N,5-N,7-N-tetrakis(4-hydroxyphenyl)-1,1,3,5,7-pentamethylnonane-1,3,5,7-tetracarboxamide (PubChem CID 134463643) has the molecular formula C42H50N4O8 and a molecular weight of 738.88 g/mol. Its IUPAC name is 1-N,3-N,5-N,7-N-tetrakis(4-hydroxyphenyl)-1,1,3,5,7-pentamethylnonane-1,3,5,7-tetracarboxamide.
| Compound Name | 1-N,3-N,5-N,7-N-tetrakis(4-hydroxyphenyl)-1,1,3,5,7-pentamethylnonane-1,3,5,7-tetracarboxamide |
|---|---|
| PubChem CID | 134463643 |
| Molecular Formula | C42H50N4O8 |
| Molecular Weight | 738.88 g/mol |
| Exact Mass | 738.36 |
| IUPAC Name | 1-N,3-N,5-N,7-N-tetrakis(4-hydroxyphenyl)-1,1,3,5,7-pentamethylnonane-1,3,5,7-tetracarboxamide |
| SMILES | CCC(C)(CC(C)(CC(C)(CC(C)(C)C(=O)Nc1ccc(O)cc1)C(=O)Nc1ccc(O)cc1)C(=O)Nc1ccc(O)cc1)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C42H50N4O8/c1-7-40(4,36(52)44-28-10-18-32(48)19-11-28)25-42(6,38(54)46-30-14-22-34(50)23-15-30)26-41(5,37(53)45-29-12-20-33(49)21-13-29)24-39(2,3)35(51)43-27-8-16-31(47)17-9-27/h8-23,47-50H,7,24-26H2,1-6H3,(H,43,51)(H,44,52)(H,45,53)(H,46,54) |
| InChIKey | FUYFQPFQFNRJAX-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 197.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.88 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|